3,6-Dimethyl-2-phenyl Morpholine Hydrochloride(Mixture of DiastereoMers) structure
|
Common Name | 3,6-Dimethyl-2-phenyl Morpholine Hydrochloride(Mixture of DiastereoMers) | ||
|---|---|---|---|---|
| CAS Number | 92902-99-3 | Molecular Weight | 191.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dimethyl-2-phenylmorpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H17NO |
|---|---|
| Molecular Weight | 191.26900 |
| Exact Mass | 191.13100 |
| PSA | 21.26000 |
| LogP | 2.45330 |
| InChIKey | BSLZIUNPWSDRII-UHFFFAOYSA-N |
| SMILES | CC1CNC(C)C(c2ccccc2)O1.Cl |
| 2-Phenyl-3,6-dimethylmorpholine |