Sulfo-SMPB sodium structure
|
Common Name | Sulfo-SMPB sodium | ||
|---|---|---|---|---|
| CAS Number | 92921-26-1 | Molecular Weight | 458.37400 | |
| Density | 1.66g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H15N2NaO9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfo-SMPB sodiumSulfo-SMPB sodium is a non-cleavable, heterobifunctional chemical cross-linking reagent which contains N-hydroxysuccinimide (NHS) ester and maleimide groups, allowing covalent conjugation of amine- and sulfhydryl-containing molecules[1]. |
| Name | 1-[4-[4-(2,5-dioxopyrrol-1-yl)phenyl]butanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfo-SMPB sodium is a non-cleavable, heterobifunctional chemical cross-linking reagent which contains N-hydroxysuccinimide (NHS) ester and maleimide groups, allowing covalent conjugation of amine- and sulfhydryl-containing molecules[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.66g/cm3 |
|---|---|
| Molecular Formula | C18H15N2NaO9S |
| Molecular Weight | 458.37400 |
| Exact Mass | 458.04000 |
| PSA | 166.64000 |
| LogP | 0.65330 |
| Index of Refraction | 1.674 |
| InChIKey | VHYRLCJMMJQUBY-UHFFFAOYSA-N |
| SMILES | O=C(CCCc1ccc(N2C(=O)C=CC2=O)cc1)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| bicl201 |