trans-R-138727MP structure
|
Common Name | trans-R-138727MP | ||
|---|---|---|---|---|
| CAS Number | 929211-64-3 | Molecular Weight | 497.57800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H28FNO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of trans-R-138727MPtrans-R-138727MP (Prasugrel metabolite R-138727MP) is the active metabolite derivative of Prasugrel (HY-15284). Prasugrel, a thienopyridine and prodrug, inhibits platelet function. Prasugrel is an orally active and potent P2Y12 receptor antagonist, and inhibits ADP-induced platelet aggregation[1]. |
| Name | (2Z)-2-[1-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylpiperidin-3-ylidene]acetic acid |
|---|
| Description | trans-R-138727MP (Prasugrel metabolite R-138727MP) is the active metabolite derivative of Prasugrel (HY-15284). Prasugrel, a thienopyridine and prodrug, inhibits platelet function. Prasugrel is an orally active and potent P2Y12 receptor antagonist, and inhibits ADP-induced platelet aggregation[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H28FNO5S |
|---|---|
| Molecular Weight | 497.57800 |
| Exact Mass | 497.16700 |
| PSA | 109.21000 |
| LogP | 4.49380 |
| InChIKey | HNPJXQKTFJGUSO-RGEXLXHISA-N |
| SMILES | COc1cccc(C(=O)CSC2CCN(C(C(=O)C3CC3)c3ccccc3F)CC2=CC(=O)O)c1 |