N-(9-methyl-9H-fluoren-2-yl)acetamide
Modify Date: 2025-09-02 20:53:40
N-(9-methyl-9H-fluoren-2-yl)acetamide structure
|
Common Name | N-(9-methyl-9H-fluoren-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 92962-35-1 | Molecular Weight | 237.29600 | |
| Density | 1.178g/cm3 | Boiling Point | 450.1ºC at 760 mmHg | |
| Molecular Formula | C16H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.1ºC | |
| Name | N-(9-methyl-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 450.1ºC at 760 mmHg |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.29600 |
| Flash Point | 271.1ºC |
| Exact Mass | 237.11500 |
| PSA | 29.10000 |
| LogP | 3.85020 |
| Index of Refraction | 1.642 |
| InChIKey | CWMXBOWBENDGOR-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc2c(c1)C(C)c1ccccc1-2 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Acetylamino-9-methyl-fluoren |
| 2-Acetamino-9-methyl-fluoren |