(3-ethyl-4-methyl-phenyl) 4-nitrobenzoate structure
|
Common Name | (3-ethyl-4-methyl-phenyl) 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 92963-86-5 | Molecular Weight | 285.29500 | |
| Density | 1.22g/cm3 | Boiling Point | 434.3ºC at 760 mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9ºC | |
| Name | (3-ethyl-4-methylphenyl) 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 434.3ºC at 760 mmHg |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 181.9ºC |
| Exact Mass | 285.10000 |
| PSA | 72.12000 |
| LogP | 4.20800 |
| Index of Refraction | 1.589 |
| InChIKey | HIZHZSFIMQFWOY-UHFFFAOYSA-N |
| SMILES | CCc1cc(OC(=O)c2ccc([N+](=O)[O-])cc2)ccc1C |
|
~%
(3-ethyl-4-meth... CAS#:92963-86-5 |
| Literature: Baddeley Journal of the Chemical Society, 1944 , p. 330 |
|
~%
(3-ethyl-4-meth... CAS#:92963-86-5 |
| Literature: Baddeley Journal of the Chemical Society, 1944 , p. 330 |
|
~%
(3-ethyl-4-meth... CAS#:92963-86-5 |
| Literature: Baddeley Journal of the Chemical Society, 1944 , p. 330 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-ethyl-4-methylphenyl 4-nitrobenzoate |