1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine
Modify Date: 2025-08-30 09:12:54
![1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine Structure](https://www.chemsrc.com/extcaspic/232/929972-76-9.png)
1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine structure
|
Common Name | 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine | ||
|---|---|---|---|---|
| CAS Number | 929972-76-9 | Molecular Weight | 263.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17N3OS |
|---|---|
| Molecular Weight | 263.36 |
| InChIKey | ICFLFQHCMBWUIS-UHFFFAOYSA-N |
| SMILES | Cc1oc(-c2cccs2)nc1CN1CCNCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine? |
| A: Molecular formula of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine is C13H17N3OS. |
| Q: What is the molecular weight of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine? |
| A: Molecular weight of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine is 263.36. |
| Q: What is the Chinese name of 929972-76-9? |
| A: Chinese name of 929972-76-9 is 929972-76-9. |
| Q: What is the SMILES notation of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine? |
| A: SMILES notation of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine is Cc1oc(-c2cccs2)nc1CN1CCNCC1. |
| Q: What is the English name of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine? |
| A: The English name of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine is 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine. |
| Q: What is the InChIKey of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine? |
| A: InChIKey of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine is ICFLFQHCMBWUIS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine? |
| A: CAS number of 1-{[5-Methyl-2-(thiophen-2-YL)-1,3-oxazol-4-YL]methyl}piperazine is 929972-76-9. |