N-[2-(3,4-dimethoxyphenyl)-1-methylethyl]-4-ethoxy-3-methoxyphenylacetamide structure
|
Common Name | N-[2-(3,4-dimethoxyphenyl)-1-methylethyl]-4-ethoxy-3-methoxyphenylacetamide | ||
|---|---|---|---|---|
| CAS Number | 93-31-2 | Molecular Weight | 387.46900 | |
| Density | 1.235g/cm3 | Boiling Point | 585.4ºC at 760 mmHg | |
| Molecular Formula | C22H29NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.8ºC | |
| Name | N-[1-(3,4-dimethoxyphenyl)propan-2-yl]-2-(4-ethoxy-3-methoxyphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 585.4ºC at 760 mmHg |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.46900 |
| Flash Point | 307.8ºC |
| Exact Mass | 387.20500 |
| PSA | 69.51000 |
| LogP | 4.24130 |
| Index of Refraction | 1.583 |
| InChIKey | UGBCLZKPTMPXNS-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(CC(=O)NC(C)Cc2ccc(OC)c(OC)c2)cc1OC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 202-238-2 |