METHYL (4-PHENYL-1,3-THIAZOL-2-YL)ACETATE structure
|
Common Name | METHYL (4-PHENYL-1,3-THIAZOL-2-YL)ACETATE | ||
|---|---|---|---|---|
| CAS Number | 93001-82-2 | Molecular Weight | 233.28600 | |
| Density | 1.226g/cm3 | Boiling Point | 366.9ºC at 760mmHg | |
| Molecular Formula | C12H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.7ºC | |
| Name | methyl 2-(4-phenyl-1,3-thiazol-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 366.9ºC at 760mmHg |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.28600 |
| Flash Point | 175.7ºC |
| Exact Mass | 233.05100 |
| PSA | 67.43000 |
| LogP | 2.52560 |
| Index of Refraction | 1.579 |
| InChIKey | OGNQEXKJRUCLAY-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1nc(-c2ccccc2)cs1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Methoxycarbonylmethyl-4-phenylthiazol |
| methyl (4-phenyl-1,3-thiazol-2-yl)acetate |
| HMS1776C22 |