Benzenesulfonamide,N-(2,3-dihydro-1H-inden-1-yl)-4-methyl
Benzenesulfonamide,N-(2,3-dihydro-1H-inden-1-yl)-4-methyl structure
|
Common Name | Benzenesulfonamide,N-(2,3-dihydro-1H-inden-1-yl)-4-methyl | ||
|---|---|---|---|---|
| CAS Number | 93008-98-1 | Molecular Weight | 287.37700 | |
| Density | 1.28g/cm3 | Boiling Point | 449.6ºC at 760 mmHg | |
| Molecular Formula | C16H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 449.6ºC at 760 mmHg |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.37700 |
| Flash Point | 225.7ºC |
| Exact Mass | 287.09800 |
| PSA | 54.55000 |
| LogP | 4.43250 |
| Index of Refraction | 1.636 |
| InChIKey | FFIKGCMGCYXTKX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC2CCc3ccccc32)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:496-11-7
CAS#:70-55-3
CAS#:41085-71-6
CAS#:127-65-1
CAS#:95-13-6
CAS#:6351-10-6
CAS#:21849-40-1
CAS#:7080-50-4
CAS#:19618-96-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-indan-1-yl-4-methyl-benzenesulfonamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide? |
| A: LogP of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide is 4.43250. |
| Q: What is the Chinese name of 93008-98-1? |
| A: Chinese name of 93008-98-1 is 93008-98-1. |
| Q: What is the molecular weight of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide? |
| A: Molecular weight of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide is 287.37700. |
| Q: What English synonyms does N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide have? |
| A: English synonyms of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide: N-indan-1-yl-4-methyl-benzenesulfonamide. |
| Q: What is the English name of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide? |
| A: The English name of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide is N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide. |
| Q: What is the CAS number of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide? |
| A: CAS number of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide is 93008-98-1. |
| Q: What is the SMILES notation of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide? |
| A: SMILES notation of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)NC2CCc3ccccc32)cc1. |
| Q: What is the boiling point of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide? |
| A: Boiling point of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide is 449.6ºC at 760 mmHg. |
| Q: What is the InChIKey of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide? |
| A: InChIKey of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide is FFIKGCMGCYXTKX-UHFFFAOYSA-N. |
| Q: What are the upstream materials of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide? |
| A: Related upstream materials(CAS) of N-(2,3-dihydro-1H-inden-1-yl)-4-methylbenzenesulfonamide: 496-11-7;70-55-3;41085-71-6;127-65-1;95-13-6;6351-10-6;21849-40-1;7080-50-4;19618-96-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |