[4-(3,5-dimethylpyrazol-1-yl)phenyl]methanamine structure
|
Common Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 930111-11-8 | Molecular Weight | 201.26800 | |
| Density | 1.123g/cm3 | Boiling Point | 336.862ºC at 760 mmHg | |
| Molecular Formula | C12H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.529ºC | |
| Name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]methanamine |
|---|
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 336.862ºC at 760 mmHg |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.26800 |
| Flash Point | 157.529ºC |
| Exact Mass | 201.12700 |
| PSA | 43.84000 |
| LogP | 2.64810 |
| Index of Refraction | 1.6 |
| InChIKey | PARNNKGLJSIUFI-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(-c2ccc(CN)cc2)n1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |