6-(4-hydroxyphenyl)-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one structure
|
Common Name | 6-(4-hydroxyphenyl)-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one | ||
|---|---|---|---|---|
| CAS Number | 93015-32-8 | Molecular Weight | 242.31300 | |
| Density | 1.18g/cm3 | Boiling Point | 443.7ºC at 760 mmHg | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.1ºC | |
| Name | 6-(4-hydroxyphenyl)-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 443.7ºC at 760 mmHg |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.31300 |
| Flash Point | 189.1ºC |
| Exact Mass | 242.13100 |
| PSA | 37.30000 |
| LogP | 3.56520 |
| Index of Refraction | 1.6 |
| InChIKey | XPJANFHNOXAWAT-UHFFFAOYSA-N |
| SMILES | O=C1C=C2CCC(c3ccc(O)cc3)CC2CC1 |
|
~%
6-(4-hydroxyphe... CAS#:93015-32-8 |
| Literature: Juday,R.E. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 519 - 524 |
| 4,4a,5,6,7,8-Hexahydro-6-(p-hydroxyphenyl)-2(3H)-naphthalenone |
| 4.4a.5.6.7.8-Hexahydro-6-(p-hydroxy-phenyl)-2(3H)-naphthalenon |