Sucrose 1',6-dicaprylate
Modify Date: 2025-08-23 18:04:50
Sucrose 1',6-dicaprylate structure
|
Common Name | Sucrose 1',6-dicaprylate | ||
|---|---|---|---|---|
| CAS Number | 930287-53-9 | Molecular Weight | 594.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H50O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sucrose 1',6-dicaprylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H50O13 |
|---|---|
| Molecular Weight | 594.7 |
| InChIKey | XMWKJMHPPVSYEN-AVONVRORSA-N |
| SMILES | CCCCCCCC(=O)OCC1OC(OC2(COC(=O)CCCCCCC)OC(CO)C(O)C2O)C(O)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 930287-53-9? |
| A: Chinese name of 930287-53-9 is 930287-53-9. |
| Q: What is the molecular weight of Sucrose 1',6-dicaprylate? |
| A: Molecular weight of Sucrose 1',6-dicaprylate is 594.7. |
| Q: What is the CAS number of Sucrose 1',6-dicaprylate? |
| A: CAS number of Sucrose 1',6-dicaprylate is 930287-53-9. |
| Q: What is the English name of Sucrose 1',6-dicaprylate? |
| A: The English name of Sucrose 1',6-dicaprylate is Sucrose 1',6-dicaprylate. |
| Q: What is the SMILES notation of Sucrose 1',6-dicaprylate? |
| A: SMILES notation of Sucrose 1',6-dicaprylate is CCCCCCCC(=O)OCC1OC(OC2(COC(=O)CCCCCCC)OC(CO)C(O)C2O)C(O)C(O)C1O. |
| Q: What is the InChIKey of Sucrose 1',6-dicaprylate? |
| A: InChIKey of Sucrose 1',6-dicaprylate is XMWKJMHPPVSYEN-AVONVRORSA-N. |
| Q: What is the molecular formula of Sucrose 1',6-dicaprylate? |
| A: Molecular formula of Sucrose 1',6-dicaprylate is C28H50O13. |