5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide
Modify Date: 2025-10-24 06:18:44
![5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide Structure](https://www.chemsrc.com/extcaspic/059/930451-72-2.png)
5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide structure
|
Common Name | 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 930451-72-2 | Molecular Weight | 379.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H20Cl2N4O |
|---|---|
| Molecular Weight | 379.3 |
| InChIKey | HTZNZNUDWAOWEH-UHFFFAOYSA-N |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cnc(Cl)c(Cl)c3)cc2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide? |
| A: Molecular formula of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide is C18H20Cl2N4O. |
| Q: What is the molecular weight of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide? |
| A: Molecular weight of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide is 379.3. |
| Q: What is the InChIKey of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide? |
| A: InChIKey of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide is HTZNZNUDWAOWEH-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide? |
| A: CAS number of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide is 930451-72-2. |
| Q: What is the SMILES notation of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide? |
| A: SMILES notation of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide is CCN1CCN(c2ccc(NC(=O)c3cnc(Cl)c(Cl)c3)cc2)CC1. |
| Q: What is the Chinese name of 930451-72-2? |
| A: Chinese name of 930451-72-2 is 930451-72-2. |
| Q: What is the English name of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide? |
| A: The English name of 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide is 5,6-dichloro-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyridine-3-carboxamide. |