2-(4-chlorophenyl)-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]ethene-1-sulfonamide structure
|
Common Name | 2-(4-chlorophenyl)-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]ethene-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 930458-21-2 | Molecular Weight | 379.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenyl)-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]ethene-1-sulfonamide |
|---|
| Molecular Formula | C18H18ClNO4S |
|---|---|
| Molecular Weight | 379.9 |
| InChIKey | WRCASDGUTPZVFF-DHZHZOJOSA-N |
| SMILES | CC(NS(=O)(=O)C=Cc1ccc(Cl)cc1)c1ccc2c(c1)OCCO2 |
|
Name: Phenotypic Assay to Identify Small Molecules that Upregulate Production of hCFTR in H...
Source: Southern Research Institute
Target: CFTR
External Id: CF Folding
|