1,3-Diethyl 2-{3-[4,6-dimethyl-2-(methylsulfanyl)pyrimidin-5-yl]propanamido}propanedioate structure
|
Common Name | 1,3-Diethyl 2-{3-[4,6-dimethyl-2-(methylsulfanyl)pyrimidin-5-yl]propanamido}propanedioate | ||
|---|---|---|---|---|
| CAS Number | 930490-19-0 | Molecular Weight | 383.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-Diethyl 2-{3-[4,6-dimethyl-2-(methylsulfanyl)pyrimidin-5-yl]propanamido}propanedioate |
|---|
| Molecular Formula | C17H25N3O5S |
|---|---|
| Molecular Weight | 383.5 |
| InChIKey | QXRIUOYEFKHMHK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(NC(=O)CCc1c(C)nc(SC)nc1C)C(=O)OCC |
|
Name: Phenotypic Assay to Identify Small Molecules that Upregulate Production of hCFTR in H...
Source: Southern Research Institute
Target: CFTR
External Id: CF Folding
|