N-(1,3-dihydro-2H-benzimidazol-2-ylidene)-3-methyl-6-(propan-2-yl)[1,2]oxazolo[5,4-b]pyridine-4-carboxamide structure
|
Common Name | N-(1,3-dihydro-2H-benzimidazol-2-ylidene)-3-methyl-6-(propan-2-yl)[1,2]oxazolo[5,4-b]pyridine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 930537-23-8 | Molecular Weight | 335.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1,3-dihydro-2H-benzimidazol-2-ylidene)-3-methyl-6-(propan-2-yl)[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|
| Molecular Formula | C18H17N5O2 |
|---|---|
| Molecular Weight | 335.4 |
| InChIKey | RUNVLRBGGJRXQB-UHFFFAOYSA-N |
| SMILES | Cc1noc2nc(C(C)C)cc(C(=O)Nc3nc4ccccc4[nH]3)c12 |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|