tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate
Modify Date: 2026-08-28 13:49:12
![tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate Structure](https://www.chemsrc.com/extcaspic/152/930604-31-2.png)
tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate structure
|
Common Name | tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 930604-31-2 | Molecular Weight | 293.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H27N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H27N3O2 |
|---|---|
| Molecular Weight | 293.40 |
| InChIKey | IHZFLXBXQCGGDM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCC(C#N)CC2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate? |
| A: Molecular weight of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate is 293.40. |
| Q: What is the InChIKey of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate? |
| A: InChIKey of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate is IHZFLXBXQCGGDM-UHFFFAOYSA-N. |
| Q: What is the English name of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate? |
| A: The English name of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate is tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate. |
| Q: What is the Chinese name of 930604-31-2? |
| A: Chinese name of 930604-31-2 is 930604-31-2. |
| Q: What is the molecular formula of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate? |
| A: Molecular formula of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate is C16H27N3O2. |
| Q: What is the CAS number of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate? |
| A: CAS number of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate is 930604-31-2. |
| Q: What is the SMILES notation of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate? |
| A: SMILES notation of tert-Butyl 4-cyano-[1,4'-bipiperidine]-1'-carboxylate is CC(C)(C)OC(=O)N1CCC(N2CCC(C#N)CC2)CC1. |