N-butan-2-yl-4-oxo-4-[3-(trifluoromethyl)phenyl]butanamide structure
|
Common Name | N-butan-2-yl-4-oxo-4-[3-(trifluoromethyl)phenyl]butanamide | ||
|---|---|---|---|---|
| CAS Number | 93061-41-7 | Molecular Weight | 301.30400 | |
| Density | 1.159g/cm3 | Boiling Point | 414.9ºC at 760 mmHg | |
| Molecular Formula | C15H18F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.7ºC | |
| Name | N-butan-2-yl-4-oxo-4-[3-(trifluoromethyl)phenyl]butanamide |
|---|
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 414.9ºC at 760 mmHg |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.30400 |
| Flash Point | 204.7ºC |
| Exact Mass | 301.12900 |
| PSA | 49.66000 |
| LogP | 4.42330 |
| Index of Refraction | 1.471 |
| InChIKey | ZLBAARCCDNQYSJ-UHFFFAOYSA-N |
| SMILES | CCC(C)NC(=O)CCC(=O)c1cccc(C(F)(F)F)c1 |
|
~%
N-butan-2-yl-4-... CAS#:93061-41-7 |
| Literature: Houlihan, William J.; Gogerty, John H.; Ryan, Eileen A.; Schmitt, Gemma Journal of Medicinal Chemistry, 1985 , vol. 28, # 1 p. 28 - 31 |