2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline
2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline structure
|
Common Name | 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline | ||
|---|---|---|---|---|
| CAS Number | 93075-15-1 | Molecular Weight | 325.72800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8ClN3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Chloro-6-(2,4-dinitrophenyl)sulfanylaniline, Chinese name: 2-氯-6-(2,4-二硝基苯基)硫代苯胺, CAS number: 93075-15-1, molecular formula: C12H8ClN3O4S, molecular weight: 325.72800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8ClN3O4S |
|---|---|
| Molecular Weight | 325.72800 |
| Exact Mass | 324.99200 |
| PSA | 142.96000 |
| LogP | 5.51740 |
| InChIKey | SQEVRJCRHWNZQA-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)cccc1Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~80%
2-chloro-6-(2,4... CAS#:93075-15-1 |
| Literature: Gupta; Kalwania; Kumar Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 3 p. 893 - 896 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline? |
| A: SMILES notation of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline is Nc1c(Cl)cccc1Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-]. |
| Q: What is the LogP of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline? |
| A: LogP of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline is 5.51740. |
| Q: What is the polar surface area (PSA) of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline? |
| A: Polar surface area (PSA) of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline is 142.96000. |
| Q: What is the molecular weight of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline? |
| A: Molecular weight of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline is 325.72800. |
| Q: What is the InChIKey of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline? |
| A: InChIKey of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline is SQEVRJCRHWNZQA-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 93075-15-1? |
| A: Chinese name of 93075-15-1 is 93075-15-1. |
| Q: What is the English name of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline? |
| A: The English name of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline is 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline. |
| Q: What is the CAS number of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline? |
| A: CAS number of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline is 93075-15-1. |
| Q: What is the molecular formula of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline? |
| A: Molecular formula of 2-chloro-6-(2,4-dinitrophenyl)sulfanylaniline is C12H8ClN3O4S. |