1h-Indole-5-carboxamide,n-(3-chlorophenyl)
Modify Date: 2026-08-17 15:10:38
1h-Indole-5-carboxamide,n-(3-chlorophenyl) structure
|
Common Name | 1h-Indole-5-carboxamide,n-(3-chlorophenyl) | ||
|---|---|---|---|---|
| CAS Number | 930791-10-9 | Molecular Weight | 270.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1h-Indole-5-carboxamide,n-(3-chlorophenyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11ClN2O |
|---|---|
| Molecular Weight | 270.71 |
| InChIKey | VYHQXYUNBVAVOX-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc2[nH]ccc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 930791-10-9? |
| A: Chinese name of 930791-10-9 is 930791-10-9. |
| Q: What is the English name of 1h-Indole-5-carboxamide,n-(3-chlorophenyl)? |
| A: The English name of 1h-Indole-5-carboxamide,n-(3-chlorophenyl) is 1h-Indole-5-carboxamide,n-(3-chlorophenyl). |
| Q: What is the InChIKey of 1h-Indole-5-carboxamide,n-(3-chlorophenyl)? |
| A: InChIKey of 1h-Indole-5-carboxamide,n-(3-chlorophenyl) is VYHQXYUNBVAVOX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1h-Indole-5-carboxamide,n-(3-chlorophenyl)? |
| A: Molecular weight of 1h-Indole-5-carboxamide,n-(3-chlorophenyl) is 270.71. |
| Q: What is the molecular formula of 1h-Indole-5-carboxamide,n-(3-chlorophenyl)? |
| A: Molecular formula of 1h-Indole-5-carboxamide,n-(3-chlorophenyl) is C15H11ClN2O. |
| Q: What is the SMILES notation of 1h-Indole-5-carboxamide,n-(3-chlorophenyl)? |
| A: SMILES notation of 1h-Indole-5-carboxamide,n-(3-chlorophenyl) is O=C(Nc1cccc(Cl)c1)c1ccc2[nH]ccc2c1. |
| Q: What is the CAS number of 1h-Indole-5-carboxamide,n-(3-chlorophenyl)? |
| A: CAS number of 1h-Indole-5-carboxamide,n-(3-chlorophenyl) is 930791-10-9. |