Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro
Modify Date: 2026-08-21 09:56:46
![Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro Structure](https://www.chemsrc.com/extcaspic/318/930797-62-9.png)
Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro structure
|
Common Name | Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro | ||
|---|---|---|---|---|
| CAS Number | 930797-62-9 | Molecular Weight | 272.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16N2O3 |
|---|---|
| Molecular Weight | 272.30 |
| InChIKey | LTWHKOMPBNVASZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(COc2cc([N+](=O)[O-])ccc2N)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro? |
| A: SMILES notation of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro is Cc1ccc(C)c(COc2cc([N+](=O)[O-])ccc2N)c1. |
| Q: What is the CAS number of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro? |
| A: CAS number of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro is 930797-62-9. |
| Q: What is the molecular formula of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro? |
| A: Molecular formula of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro is C15H16N2O3. |
| Q: What is the Chinese name of 930797-62-9? |
| A: Chinese name of 930797-62-9 is 930797-62-9. |
| Q: What is the English name of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro? |
| A: The English name of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro is Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro. |
| Q: What is the InChIKey of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro? |
| A: InChIKey of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro is LTWHKOMPBNVASZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro? |
| A: Molecular weight of Benzenamine, 2-[(2,5-dimethylphenyl)methoxy]-4-nitro is 272.30. |