I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate
Modify Date: 2026-07-27 17:48:26
I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate structure
|
Common Name | I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate | ||
|---|---|---|---|---|
| CAS Number | 93091-75-9 | Molecular Weight | 751.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H66O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C41H66O12 |
|---|---|
| Molecular Weight | 751.0 |
| InChIKey | VXRNZMDDBZNPKJ-LFGJQLCQSA-N |
| SMILES | CC1(C)CCC2(C(=O)OC3OC(CO)C(O)C(O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OCC(O)C(O)C6O)C(C)(C)C5CCC43C)C2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate? |
| A: Molecular formula of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate is C41H66O12. |
| Q: What is the SMILES notation of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate? |
| A: SMILES notation of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate is CC1(C)CCC2(C(=O)OC3OC(CO)C(O)C(O)C3O)CCC3(C)C(=CCC4C5(C)CCC(OC6OCC(O)C(O)C6O)C(C)(C)C5CCC43C)C2C1. |
| Q: What is the CAS number of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate? |
| A: CAS number of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate is 93091-75-9. |
| Q: What is the English name of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate? |
| A: The English name of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate is I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate. |
| Q: What is the InChIKey of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate? |
| A: InChIKey of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate is VXRNZMDDBZNPKJ-LFGJQLCQSA-N. |
| Q: What is the molecular weight of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate? |
| A: Molecular weight of I(2)-D-Glucopyranosyl (3I(2))-3-(I+/--L-arabinopyranosyloxy)olean-12-en-28-oate is 751.0. |
| Q: What is the Chinese name of 93091-75-9? |
| A: Chinese name of 93091-75-9 is 93091-75-9. |