4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide
Modify Date: 2026-08-02 20:01:30
![4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide Structure](https://www.chemsrc.com/extcaspic/194/930992-24-8.png)
4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide structure
|
Common Name | 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide | ||
|---|---|---|---|---|
| CAS Number | 930992-24-8 | Molecular Weight | 439.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H21N3O5S |
|---|---|
| Molecular Weight | 439.5 |
| InChIKey | WFHROHLVICYMEE-WYMLVPIESA-N |
| SMILES | NC(=O)c1ccc(NC(=O)CN(Cc2ccco2)S(=O)(=O)C=Cc2ccccc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide? |
| A: SMILES notation of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide is NC(=O)c1ccc(NC(=O)CN(Cc2ccco2)S(=O)(=O)C=Cc2ccccc2)cc1. |
| Q: What is the InChIKey of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide? |
| A: InChIKey of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide is WFHROHLVICYMEE-WYMLVPIESA-N. |
| Q: What is the English name of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide? |
| A: The English name of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide is 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide. |
| Q: What is the molecular formula of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide? |
| A: Molecular formula of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide is C22H21N3O5S. |
| Q: What is the molecular weight of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide? |
| A: Molecular weight of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide is 439.5. |
| Q: What is the Chinese name of 930992-24-8? |
| A: Chinese name of 930992-24-8 is 930992-24-8. |
| Q: What is the CAS number of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide? |
| A: CAS number of 4-(2-{N-[(furan-2-yl)methyl]-2-phenylethenesulfonamido}acetamido)benzamide is 930992-24-8. |