4-[(4-chlorophenyl)methyl]-1,3-dihydroimidazole-2-thione structure
|
Common Name | 4-[(4-chlorophenyl)methyl]-1,3-dihydroimidazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 93103-24-3 | Molecular Weight | 224.71000 | |
| Density | 1.38g/cm3 | Boiling Point | 344.6ºC at 760 mmHg | |
| Molecular Formula | C10H9ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.2ºC | |
| Name | 4-[(4-chlorophenyl)methyl]-1,3-dihydroimidazole-2-thione |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 344.6ºC at 760 mmHg |
| Molecular Formula | C10H9ClN2S |
| Molecular Weight | 224.71000 |
| Flash Point | 162.2ºC |
| Exact Mass | 224.01700 |
| PSA | 67.48000 |
| LogP | 2.94260 |
| Index of Refraction | 1.692 |
| InChIKey | UTRATPYFFGDPIL-UHFFFAOYSA-N |
| SMILES | S=c1[nH]cc(Cc2ccc(Cl)cc2)[nH]1 |
|
~65%
4-[(4-chlorophe... CAS#:93103-24-3 |
| Literature: Maeda; Suzuki; Iwasaki; Matsumoto; Iwasawa Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 7 p. 2536 - 2543 |
|
~%
4-[(4-chlorophe... CAS#:93103-24-3 |
| Literature: Maeda; Suzuki; Iwasaki; Matsumoto; Iwasawa Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 7 p. 2536 - 2543 |