2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate
Modify Date: 2026-07-24 18:39:48
![2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate Structure](https://www.chemsrc.com/extcaspic/058/93157-29-0.png)
2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate structure
|
Common Name | 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 93157-29-0 | Molecular Weight | 280.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24O4 |
|---|---|
| Molecular Weight | 280.36 |
| InChIKey | KRHHQVPSBBPTRW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2(CC3(CCC3)C2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate? |
| A: CAS number of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate is 93157-29-0. |
| Q: What is the InChIKey of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate? |
| A: InChIKey of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate is KRHHQVPSBBPTRW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate? |
| A: SMILES notation of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate is CCOC(=O)C1(C(=O)OCC)CC2(CC3(CCC3)C2)C1. |
| Q: What is the molecular formula of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate? |
| A: Molecular formula of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate is C16H24O4. |
| Q: What is the Chinese name of 93157-29-0? |
| A: Chinese name of 93157-29-0 is 93157-29-0. |
| Q: What is the molecular weight of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate? |
| A: Molecular weight of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate is 280.36. |
| Q: What is the English name of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate? |
| A: The English name of 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate is 2,2-Diethyl dispiro[3.1.3^{6}.1^{4}]decane-2,2-dicarboxylate. |