1-(2,3-dimethoxypropyl)-4-(2-methoxyphenyl)piperazine structure
|
Common Name | 1-(2,3-dimethoxypropyl)-4-(2-methoxyphenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 93162-33-5 | Molecular Weight | 294.38900 | |
| Density | 1.062g/cm3 | Boiling Point | 408.9ºC at 760 mmHg | |
| Molecular Formula | C16H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.5ºC | |
| Name | 1-(2,3-dimethoxypropyl)-4-(2-methoxyphenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.062g/cm3 |
|---|---|
| Boiling Point | 408.9ºC at 760 mmHg |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.38900 |
| Flash Point | 117.5ºC |
| Exact Mass | 294.19400 |
| PSA | 34.17000 |
| LogP | 1.48150 |
| Index of Refraction | 1.513 |
| InChIKey | AZKRCKQYJPKNPS-UHFFFAOYSA-N |
| SMILES | COCC(CN1CCN(c2ccccc2OC)CC1)OC |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-<2,3-Dimethoxy-propyl>-4-<2-methoxy-phenyl>-piperazin |