Lodaxaprine structure
|
Common Name | Lodaxaprine | ||
|---|---|---|---|---|
| CAS Number | 93181-81-8 | Molecular Weight | 289.76000 | |
| Density | 1.303g/cm3 | Boiling Point | 525.5ºC at 760 mmHg | |
| Molecular Formula | C15H16ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.6ºC | |
| Name | 1-[6-(2-chlorophenyl)pyridazin-3-yl]piperidin-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 525.5ºC at 760 mmHg |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.76000 |
| Flash Point | 271.6ºC |
| Exact Mass | 289.09800 |
| PSA | 49.25000 |
| LogP | 2.82310 |
| Index of Refraction | 1.622 |
| InChIKey | USEZRIFSJXAMJD-UHFFFAOYSA-N |
| SMILES | OC1CCN(c2ccc(-c3ccccc3Cl)nn2)CC1 |
| HS Code | 2933990090 |
|---|
|
~78%
Lodaxaprine CAS#:93181-81-8 |
| Literature: Hallot; Brodin; Merlier; Brochard; Chambon; Biziere Journal of Medicinal Chemistry, 1986 , vol. 29, # 3 p. 369 - 375 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Lodaxaprium |
| 3-(4-Hydroxypiperidino)-6-(4-chlorophenyl)pyridazine |
| Lodaxaprium [Latin] |
| 1-(6-(2-Chlorophenyl)-3-pyridazinyl)-4-piperidinol |
| 3-(4-hydroxy-piperidino)-6-(2-chlorophenyl)pyridazine |
| Lodaxaprina [Spanish] |
| 4-Piperidinol,1-(6-(2-chlorophenyl)-3-pyridazinyl) |
| Lodaxaprina |
| Lodaxaprine |
| 1-(6-(o-Chlorophenyl)-3-pyridazinyl)-4-piperidinol |