N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide
Modify Date: 2025-09-09 14:44:14
![N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide Structure](https://www.chemsrc.com/extcaspic/482/931998-18-4.png)
N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide structure
|
Common Name | N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide | ||
|---|---|---|---|---|
| CAS Number | 931998-18-4 | Molecular Weight | 422.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H26N2O3S |
|---|---|
| Molecular Weight | 422.5 |
| InChIKey | OPJIOABYPBTWTB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(CCC(=O)Nc2ccc(S(=O)(=O)Nc3ccc(C)c(C)c3)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 931998-18-4? |
| A: Chinese name of 931998-18-4 is 931998-18-4. |
| Q: What is the SMILES notation of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide? |
| A: SMILES notation of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide is Cc1ccc(CCC(=O)Nc2ccc(S(=O)(=O)Nc3ccc(C)c(C)c3)cc2)cc1. |
| Q: What is the molecular weight of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide? |
| A: Molecular weight of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide is 422.5. |
| Q: What is the English name of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide? |
| A: The English name of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide is N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide. |
| Q: What is the molecular formula of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide? |
| A: Molecular formula of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide is C24H26N2O3S. |
| Q: What is the CAS number of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide? |
| A: CAS number of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide is 931998-18-4. |
| Q: What is the InChIKey of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide? |
| A: InChIKey of N-[4-[[(3,4-Dimethylphenyl)amino]sulfonyl]phenyl]-4-methylbenzenepropanamide is OPJIOABYPBTWTB-UHFFFAOYSA-N. |