2-(2-nitrophenyl)sulfonylacetamide
Modify Date: 2024-03-04 13:30:27
2-(2-nitrophenyl)sulfonylacetamide structure
|
Common Name | 2-(2-nitrophenyl)sulfonylacetamide | ||
|---|---|---|---|---|
| CAS Number | 93249-24-2 | Molecular Weight | 244.22500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-nitrophenyl)sulfonylacetamide |
|---|
| Molecular Formula | C8H8N2O5S |
|---|---|
| Molecular Weight | 244.22500 |
| Exact Mass | 244.01500 |
| PSA | 132.42000 |
| LogP | 2.60750 |
| InChIKey | YKYLMNOZZFDNEM-UHFFFAOYSA-N |
| SMILES | NC(=O)CS(=O)(=O)c1ccccc1[N+](=O)[O-] |
|
~%
2-(2-nitropheny... CAS#:93249-24-2 |
| Literature: Evans; Smiles Journal of the Chemical Society, 1936 , p. 329 |
![(2-NAPHTHYLSULFONYL)AMINO]ACETICACID structure](https://image.chemsrc.com/caspic/117/6375-65-1.png)