Ropidoxuridine structure
|
Common Name | Ropidoxuridine | ||
|---|---|---|---|---|
| CAS Number | 93265-81-7 | Molecular Weight | 338.09900 | |
| Density | 2.22g/cm3 | Boiling Point | 478.6ºC at 760mmHg | |
| Molecular Formula | C9H11IN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.3ºC | |
Use of RopidoxuridineRopidoxuridine (IPdR) is a novel orally available, halogenated thymidine analog and is a potential radiosensitizer for use in human tumors. |
| Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Ropidoxuridine (IPdR) is a novel orally available, halogenated thymidine analog and is a potential radiosensitizer for use in human tumors. |
|---|---|
| Related Catalog | |
| In Vitro | Ropidoxuridine is an orally bioavailable pro-drug of IUdR (5-iodo-2'-deoxyuridine). Ropidoxuridine demonstrates strong synergy effects with Alisertib at clinically relevant concentrations[1]. |
| In Vivo | In an orthotopic tumor model, Ropidoxuridine (750 mg/kg/day) and Alisertib (30 mg/kg/day) demonstrate strong synergy effects[1]. |
| References |
| Density | 2.22g/cm3 |
|---|---|
| Boiling Point | 478.6ºC at 760mmHg |
| Molecular Formula | C9H11IN2O4 |
| Molecular Weight | 338.09900 |
| Flash Point | 243.3ºC |
| Exact Mass | 337.97600 |
| PSA | 84.58000 |
| Index of Refraction | 1.759 |
| InChIKey | XIJXHOVKJAXCGJ-XLPZGREQSA-N |
| SMILES | O=c1ncc(I)cn1C1CC(O)C(CO)O1 |
|
~45%
Ropidoxuridine CAS#:93265-81-7 |
| Literature: Efange, Simon M. N.; Alessi, Elaine M.; Shih, H. C.; Cheng, Yung-Chi; Bardos, Thomas J. Journal of Medicinal Chemistry, 1985 , vol. 28, # 7 p. 904 - 910 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Iodo-2-pyrimidinone-2'-deoxyribose |
| Ropidoxuridine (INN/USAN) |
| IPdR |
| Ropidoxuridine |
| UNII-3HX21A3SQF |
| Ropidoxuridine [USAN:INN] |
| 5-Iodo-2-pyrimidinone 2' deoxyribonucleoside |