7,8-dimethoxy-1H-3-benzazepin-2-amine HCl structure
|
Common Name | 7,8-dimethoxy-1H-3-benzazepin-2-amine HCl | ||
|---|---|---|---|---|
| CAS Number | 93270-40-7 | Molecular Weight | 254.71300 | |
| Density | N/A | Boiling Point | 396.9ºC at 760mmHg | |
| Molecular Formula | C12H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.8ºC | |
| Name | 7,8-dimethoxy-1H-3-benzazepin-2-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 396.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.71300 |
| Flash Point | 193.8ºC |
| Exact Mass | 254.08200 |
| PSA | 54.34000 |
| LogP | 3.02800 |
| InChIKey | UCLAWHFDUTWUSU-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)CC(N)=NC=C2.Cl |
| HS Code | 2933990090 |
|---|
|
~%
7,8-dimethoxy-1... CAS#:93270-40-7
Detail
|
| Literature: Robey; Copley-Merriman; Phelps Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 3 p. 779 - 783 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7,8-Dimethoxy-1H-3-benzazepin-2-amine hcl |
| 2-Amino-7,8-dimethoxy-1H-3-benzazepine Hydrochloride |
| 1H-3-Benzazepin-2-amine,7,8-dimethoxy-,monohydrochloride |
| 7,8-dimethoxy-1H-3-benzazepin-2-amine hydrochloride |