methyl 4-(2-chloro-2-oxo-1-oxa-3-aza-2$l^C10H11ClNO5P-phosphacyclopent-3-yl)-2-hydroxy-benzoate structure
|
Common Name | methyl 4-(2-chloro-2-oxo-1-oxa-3-aza-2$l^C10H11ClNO5P-phosphacyclopent-3-yl)-2-hydroxy-benzoate | ||
|---|---|---|---|---|
| CAS Number | 93284-01-6 | Molecular Weight | 291.62500 | |
| Density | 1.55g/cm3 | Boiling Point | 428.1ºC at 760 mmHg | |
| Molecular Formula | C10H11ClNO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.7ºC | |
| Name | methyl 4-(2-chloro-2-oxo-1,3,2λ5-oxazaphospholidin-3-yl)-2-hydroxybenzoate |
|---|
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 428.1ºC at 760 mmHg |
| Molecular Formula | C10H11ClNO5P |
| Molecular Weight | 291.62500 |
| Flash Point | 212.7ºC |
| Exact Mass | 291.00600 |
| PSA | 85.88000 |
| LogP | 2.42730 |
| Index of Refraction | 1.597 |
| InChIKey | NEQYCRIJQUZAIY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N2CCOP2(=O)Cl)cc1O |
|
~%
methyl 4-(2-chl... CAS#:93284-01-6 |
| Literature: Baker,B.R. et al. Journal of Organic Chemistry, 1962 , vol. 27, p. 3283 - 3295 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |