N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea
Modify Date: 2026-08-19 10:34:39
![N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea Structure](https://www.chemsrc.com/extcaspic/491/932918-76-8.png)
N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea structure
|
Common Name | N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea | ||
|---|---|---|---|---|
| CAS Number | 932918-76-8 | Molecular Weight | 278.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H26N2S |
|---|---|
| Molecular Weight | 278.5 |
| InChIKey | NJZFMSDXIHOMFO-UHFFFAOYSA-N |
| SMILES | S=C(NC1CCCC1)NC12CC3CC(CC(C3)C1)C2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea? |
| A: The English name of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea is N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea. |
| Q: What is the CAS number of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea? |
| A: CAS number of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea is 932918-76-8. |
| Q: What is the Chinese name of 932918-76-8? |
| A: Chinese name of 932918-76-8 is 932918-76-8. |
| Q: What is the molecular formula of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea? |
| A: Molecular formula of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea is C16H26N2S. |
| Q: What is the molecular weight of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea? |
| A: Molecular weight of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea is 278.5. |
| Q: What is the SMILES notation of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea? |
| A: SMILES notation of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea is S=C(NC1CCCC1)NC12CC3CC(CC(C3)C1)C2. |
| Q: What is the InChIKey of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea? |
| A: InChIKey of N-Cyclopentyl-Na(2)-tricyclo[3.3.1.13,7]dec-1-ylthiourea is NJZFMSDXIHOMFO-UHFFFAOYSA-N. |