(1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine
Modify Date: 2025-10-18 17:56:02
(1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine structure
|
Common Name | (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 933035-46-2 | Molecular Weight | 226.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15ClN4 |
|---|---|
| Molecular Weight | 226.70 |
| InChIKey | XXNHZBQAIOYZJK-UHFFFAOYSA-N |
| SMILES | NC1CCC(Nc2ccnc(Cl)n2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine? |
| A: Molecular weight of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine is 226.70. |
| Q: What is the molecular formula of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine? |
| A: Molecular formula of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine is C10H15ClN4. |
| Q: What is the SMILES notation of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine? |
| A: SMILES notation of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine is NC1CCC(Nc2ccnc(Cl)n2)CC1. |
| Q: What is the InChIKey of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine? |
| A: InChIKey of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine is XXNHZBQAIOYZJK-UHFFFAOYSA-N. |
| Q: What is the English name of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine? |
| A: The English name of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine is (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine. |
| Q: What is the CAS number of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine? |
| A: CAS number of (1r,4r)-N1-(2-chloropyrimidin-4-yl)cyclohexane-1,4-diamine is 933035-46-2. |
| Q: What is the Chinese name of 933035-46-2? |
| A: Chinese name of 933035-46-2 is 933035-46-2. |