Carbamothioic acid,phenyl-, S-[2-[[(phenylamino)carbonyl]amino]ethyl] ester (9CI) structure
|
Common Name | Carbamothioic acid,phenyl-, S-[2-[[(phenylamino)carbonyl]amino]ethyl] ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 93311-82-1 | Molecular Weight | 315.39000 | |
| Density | 1.318g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H17N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-[2-(phenylcarbamoylamino)ethyl] N-phenylcarbamothioate |
|---|
| Density | 1.318g/cm3 |
|---|---|
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.39000 |
| Exact Mass | 315.10400 |
| PSA | 95.53000 |
| LogP | 4.31030 |
| Index of Refraction | 1.681 |
| InChIKey | UHQKEBJZUWBTQL-UHFFFAOYSA-N |
| SMILES | O=C(NCCSC(=O)Nc1ccccc1)Nc1ccccc1 |
|
~%
Carbamothioic a... CAS#:93311-82-1 |
| Literature: Ferris,A.F.; Schutz,B.A. Journal of Organic Chemistry, 1963 , vol. 28, p. 3140 - 3144 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |