1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethanone structure
|
Common Name | 1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 93344-82-2 | Molecular Weight | 235.32200 | |
| Density | 1.003g/cm3 | Boiling Point | 340.1ºC at 760mmHg | |
| Molecular Formula | C14H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.5ºC | |
| Name | 1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethanone |
|---|
| Density | 1.003g/cm3 |
|---|---|
| Boiling Point | 340.1ºC at 760mmHg |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.32200 |
| Flash Point | 159.5ºC |
| Exact Mass | 235.15700 |
| PSA | 29.54000 |
| LogP | 2.73960 |
| Index of Refraction | 1.509 |
| InChIKey | HWQXADPWWSVKPV-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1cc(C(C)=O)ccc1OC |
| HS Code | 2922509090 |
|---|
|
~58%
1-[3-(diethylam... CAS#:93344-82-2 |
| Literature: Borthakur, R. C.; Borthakur, N.; Rastogi, R. C. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1984 , vol. 23, # 3 p. 244 - 248 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |