7-chloro-3-methyl-1H-quinazoline-2,4-dione structure
|
Common Name | 7-chloro-3-methyl-1H-quinazoline-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 93355-81-8 | Molecular Weight | 210.61700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-chloro-3-methyl-1H-quinazoline-2,4-dione |
|---|
| Molecular Formula | C9H7ClN2O2 |
|---|---|
| Molecular Weight | 210.61700 |
| Exact Mass | 210.02000 |
| PSA | 55.12000 |
| LogP | 1.29250 |
| InChIKey | VBGHBXCIJAOVBC-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c2cc(Cl)ccc2c1=O |
|
~51%
7-chloro-3-meth... CAS#:93355-81-8 |
| Literature: Schneller; Ibay; Christ Journal of Heterocyclic Chemistry, 1984 , vol. 21, # 3 p. 791 - 795 |
|
~%
7-chloro-3-meth... CAS#:93355-81-8 |
| Literature: Yoneda, Fumio; Koga, Masakazu Journal of Heterocyclic Chemistry, 1989 , vol. 26, p. 49 - 53 |