4H-1-Benzothiopyran-4-one,3-(chloromethyl)-6-methyl-2-phenyl- structure
|
Common Name | 4H-1-Benzothiopyran-4-one,3-(chloromethyl)-6-methyl-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 93367-53-4 | Molecular Weight | 300.80300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13ClOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(chloromethyl)-6-methyl-2-phenylthiochromen-4-one |
|---|
| Molecular Formula | C17H13ClOS |
|---|---|
| Molecular Weight | 300.80300 |
| Exact Mass | 300.03800 |
| PSA | 45.31000 |
| LogP | 4.97570 |
| InChIKey | PEDSZIKLFVPTGS-UHFFFAOYSA-N |
| SMILES | Cc1ccc2sc(-c3ccccc3)c(CCl)c(=O)c2c1 |
|
~59%
4H-1-Benzothiop... CAS#:93367-53-4 |
| Literature: Nakazumi; Ueyama; Sonoda; Kitao Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 8 p. 2323 - 2324 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |