1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid
Modify Date: 2025-09-11 14:20:53
1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid structure
|
Common Name | 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 933692-38-7 | Molecular Weight | 190.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6N4O2 |
|---|---|
| Molecular Weight | 190.16 |
| InChIKey | DCPTVQHCFWHXTH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cn(-c2ccncc2)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid? |
| A: The English name of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid is 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid. |
| Q: What is the molecular weight of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid? |
| A: Molecular weight of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid is 190.16. |
| Q: What is the Chinese name of 933692-38-7? |
| A: Chinese name of 933692-38-7 is 933692-38-7. |
| Q: What is the SMILES notation of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid? |
| A: SMILES notation of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid is O=C(O)c1cn(-c2ccncc2)nn1. |
| Q: What is the CAS number of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid? |
| A: CAS number of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid is 933692-38-7. |
| Q: What is the molecular formula of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid? |
| A: Molecular formula of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid is C8H6N4O2. |
| Q: What is the InChIKey of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid? |
| A: InChIKey of 1-(pyridin-4-yl)-1H-1,2,3-triazole-4-carboxylic acid is DCPTVQHCFWHXTH-UHFFFAOYSA-N. |