5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid
Modify Date: 2025-09-02 10:40:21
5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid structure
|
Common Name | 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 933709-16-1 | Molecular Weight | 210.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6N2O3S |
|---|---|
| Molecular Weight | 210.21 |
| InChIKey | FULFLUOOGQNREL-UHFFFAOYSA-N |
| SMILES | Cc1ncsc1-c1cc(C(=O)O)no1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid? |
| A: Molecular formula of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid is C8H6N2O3S. |
| Q: What is the SMILES notation of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid? |
| A: SMILES notation of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid is Cc1ncsc1-c1cc(C(=O)O)no1. |
| Q: What is the CAS number of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid? |
| A: CAS number of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid is 933709-16-1. |
| Q: What is the Chinese name of 933709-16-1? |
| A: Chinese name of 933709-16-1 is 933709-16-1. |
| Q: What is the InChIKey of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid? |
| A: InChIKey of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid is FULFLUOOGQNREL-UHFFFAOYSA-N. |
| Q: What is the English name of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid? |
| A: The English name of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid is 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid. |
| Q: What is the molecular weight of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid? |
| A: Molecular weight of 5-(4-Methyl-1,3-thiazol-5-yl)-1,2-oxazole-3-carboxylic acid is 210.21. |