2(1H)-Pyridinone,1-methyl-6-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)- structure
|
Common Name | 2(1H)-Pyridinone,1-methyl-6-(1,2,3,4-tetrahydro-6-methoxy-2-naphthalenyl)- | ||
|---|---|---|---|---|
| CAS Number | 93407-17-1 | Molecular Weight | 269.33800 | |
| Density | 1.158g/cm3 | Boiling Point | 466.4ºC at 760mmHg | |
| Molecular Formula | C17H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.9ºC | |
| Name | 6-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-1-methylpyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760mmHg |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.33800 |
| Flash Point | 235.9ºC |
| Exact Mass | 269.14200 |
| PSA | 31.23000 |
| LogP | 2.66640 |
| Index of Refraction | 1.589 |
| InChIKey | ACFSRZSOLKNILS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CCC(c1cccc(=O)n1C)C2 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(6-methoxy-1,2,3,4-tetrahydro-naphthalen-2-yl)-1-methyl-1H-pyridin-2-one |
| 6-(6-Methoxy-1,2,3,4-tetrahydro-2-naphthyl)-1-methyl-2(1H)-pyridon |
| 1-Methyl-6-(1,2,3,4-tetrahydro-6-methoxy-2-naphthyl)-2(1H)-pyridone |