3-[2-methyl-5-(2-oxooxazolidin-3-yl)phenyl]oxazolidin-2-one structure
|
Common Name | 3-[2-methyl-5-(2-oxooxazolidin-3-yl)phenyl]oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 93427-59-9 | Molecular Weight | 262.26100 | |
| Density | 1.381g/cm3 | Boiling Point | 430.2ºC at 760 mmHg | |
| Molecular Formula | C13H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214ºC | |
| Name | 3-[4-methyl-3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1,3-oxazolidin-2-one |
|---|
| Density | 1.381g/cm3 |
|---|---|
| Boiling Point | 430.2ºC at 760 mmHg |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26100 |
| Flash Point | 214ºC |
| Exact Mass | 262.09500 |
| PSA | 59.08000 |
| LogP | 2.03820 |
| Index of Refraction | 1.609 |
| InChIKey | NCHCNPLQJBBLKO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2CCOC2=O)cc1N1CCOC1=O |
|
~%
3-[2-methyl-5-(... CAS#:93427-59-9 |
| Literature: Speranza; Peppel Journal of Organic Chemistry, 1958 , vol. 23, p. 1922 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |