4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl]
Modify Date: 2026-09-26 19:16:59
![4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] Structure](https://www.chemsrc.com/extcaspic/495/934353-79-4.png)
4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] structure
|
Common Name | 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] | ||
|---|---|---|---|---|
| CAS Number | 934353-79-4 | Molecular Weight | 311.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14ClN5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H14ClN5 |
|---|---|
| Molecular Weight | 311.77 |
| InChIKey | SRVCGYHPDNYELG-BQYQJAHWSA-N |
| SMILES | Cc1cc(Nc2cc(Cl)nc(C=Cc3ccccc3)n2)n[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl]? |
| A: CAS number of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] is 934353-79-4. |
| Q: What is the English name of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl]? |
| A: The English name of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] is 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl]. |
| Q: What is the Chinese name of 934353-79-4? |
| A: Chinese name of 934353-79-4 is 934353-79-4. |
| Q: What is the SMILES notation of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl]? |
| A: SMILES notation of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] is Cc1cc(Nc2cc(Cl)nc(C=Cc3ccccc3)n2)n[nH]1. |
| Q: What is the molecular formula of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl]? |
| A: Molecular formula of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] is C16H14ClN5. |
| Q: What is the InChIKey of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl]? |
| A: InChIKey of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] is SRVCGYHPDNYELG-BQYQJAHWSA-N. |
| Q: What is the molecular weight of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl]? |
| A: Molecular weight of 4-Pyrimidinamine, 6-chloro-N-(5-methyl-1H-pyrazol-3-yl)-2-[(1E)-2-phenylethenyl] is 311.77. |