4,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole structure
|
Common Name | 4,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole | ||
|---|---|---|---|---|
| CAS Number | 934365-16-9 | Molecular Weight | 388.097 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 482.6±30.0 °C at 760 mmHg | |
| Molecular Formula | C18H26B2N2O4S | Melting Point | 214 °C | |
| MSDS | Chinese USA | Flash Point | 245.7±24.6 °C | |
| Name | 4,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c][1,2,5]thiadiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 482.6±30.0 °C at 760 mmHg |
| Melting Point | 214 °C |
| Molecular Formula | C18H26B2N2O4S |
| Molecular Weight | 388.097 |
| Flash Point | 245.7±24.6 °C |
| Exact Mass | 388.179932 |
| PSA | 90.94000 |
| LogP | 2.28970 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | DHWADSHFLSDMBJ-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2ccc(B3OC(C)(C)C(C)(C)O3)c3nsnc23)OC1(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole |
| 2,1,3-Benzothiadiazole, 4,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |