4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate
Modify Date: 2025-11-18 09:09:41
![4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate Structure](https://www.chemsrc.com/extcaspic/303/93445-82-0.png)
4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate structure
|
Common Name | 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate | ||
|---|---|---|---|---|
| CAS Number | 93445-82-0 | Molecular Weight | 264.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16N2O4 |
|---|---|
| Molecular Weight | 264.28 |
| InChIKey | YHHXESOEBKZPEX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(Nc1cccc(N)c1)C(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 93445-82-0? |
| A: Chinese name of 93445-82-0 is 93445-82-0. |
| Q: What is the English name of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate? |
| A: The English name of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate is 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate. |
| Q: What is the molecular formula of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate? |
| A: Molecular formula of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate is C13H16N2O4. |
| Q: What is the CAS number of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate? |
| A: CAS number of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate is 93445-82-0. |
| Q: What is the SMILES notation of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate? |
| A: SMILES notation of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate is CCOC(=O)C=C(Nc1cccc(N)c1)C(=O)OC. |
| Q: What is the InChIKey of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate? |
| A: InChIKey of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate is YHHXESOEBKZPEX-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate? |
| A: Molecular weight of 4-Ethyl 1-methyl 2-[(3-aminophenyl)amino]-2-butenedioate is 264.28. |