Prostaglandin A1 ethyl ester structure
|
Common Name | Prostaglandin A1 ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 93464-24-5 | Molecular Weight | 364.519 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 480.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C22H36O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.3±22.2 °C | |
Use of Prostaglandin A1 ethyl esterPGA1 has been shown to cause renal vasodilation, increased urine sodium excretion, and lowered arterial pressure in hypertensive patients |
| Name | ethyl 7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopent-3-en-1-yl]heptanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 480.4±45.0 °C at 760 mmHg |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.519 |
| Flash Point | 155.3±22.2 °C |
| Exact Mass | 364.261353 |
| PSA | 63.60000 |
| LogP | 4.61 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | STQVEMJKKQYNQQ-GDZZQVLBSA-N |
| SMILES | CCCCCC(O)C=CC1C=CC(=O)C1CCCCCCC(=O)OCC |
| Prosta-10,13-dien-1-oic acid, 15-hydroxy-9-oxo-, ethyl ester, (13E,15S)- |
| Prostaglandin A1 ethyl ester |
| Ethyl (13E,15S)-15-hydroxy-9-oxoprosta-10,13-dien-1-oate |