Butanoic acid,4-(dicyclohexylamino)-, methyl ester structure
|
Common Name | Butanoic acid,4-(dicyclohexylamino)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 93478-72-9 | Molecular Weight | 281.43400 | |
| Density | 0.99g/cm3 | Boiling Point | 384.2ºC at 760 mmHg | |
| Molecular Formula | C17H31NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.4ºC | |
| Name | methyl 4-(dicyclohexylamino)butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 384.2ºC at 760 mmHg |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.43400 |
| Flash Point | 121.4ºC |
| Exact Mass | 281.23500 |
| PSA | 29.54000 |
| LogP | 3.90700 |
| Index of Refraction | 1.495 |
| InChIKey | KDOBZPSCLYCFBP-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCN(C1CCCCC1)C1CCCCC1 |
| HS Code | 2922499990 |
|---|
|
~%
Butanoic acid,4... CAS#:93478-72-9 |
| Literature: Cruickshank,P.A.; Sheehan,J.C. Journal of the American Chemical Society, 1961 , vol. 83, p. 2891 - 2895 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-Dicyclohexylamino-buttersaeure-methylester |