1-(2-ethylhexoxy)-N,N-bis(2-methylprop-2-enyl)methanimidamide structure
|
Common Name | 1-(2-ethylhexoxy)-N,N-bis(2-methylprop-2-enyl)methanimidamide | ||
|---|---|---|---|---|
| CAS Number | 93479-22-2 | Molecular Weight | 280.44900 | |
| Density | 0.88g/cm3 | Boiling Point | 336.3ºC at 760 mmHg | |
| Molecular Formula | C17H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.2ºC | |
| Name | N,N-Dimethallyl-O-<2-aethyl-hexyl>-isoharnstoff acid |
|---|
| Density | 0.88g/cm3 |
|---|---|
| Boiling Point | 336.3ºC at 760 mmHg |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.44900 |
| Flash Point | 157.2ºC |
| Exact Mass | 280.25100 |
| PSA | 36.32000 |
| LogP | 4.70810 |
| Index of Refraction | 1.464 |
| InChIKey | BXCPZVBBTJQBNG-UHFFFAOYSA-N |
| SMILES | C=C(C)CN(CC(=C)C)C(=N)OCC(CC)CCCC |
|
~%
1-(2-ethylhexox... CAS#:93479-22-2 |
| Literature: Forman,S.E. et al. Journal of Organic Chemistry, 1963 , vol. 28, p. 2653 - 2658 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |