6-Chloro-2-(trifluoromethyl)-1H-indole structure
|
Common Name | 6-Chloro-2-(trifluoromethyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 934843-27-3 | Molecular Weight | 219.591 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 294.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H5ClF3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.6±25.9 °C | |
| Name | 6-Chloro-2-(trifluoromethyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 294.0±35.0 °C at 760 mmHg |
| Molecular Formula | C9H5ClF3N |
| Molecular Weight | 219.591 |
| Flash Point | 131.6±25.9 °C |
| Exact Mass | 219.006256 |
| PSA | 15.79000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | LCZVFFOPDIBUMF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc2ccc(Cl)cc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole, 6-chloro-2-(trifluoromethyl)- |
| 6-Chloro-2-(trifluoromethyl)-1H-indole |
| 6-chloro-2-trifluoromethylindole |