(4-tert-butylcyclohexylidene)methoxymethylsulfanylbenzene structure
|
Common Name | (4-tert-butylcyclohexylidene)methoxymethylsulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 93500-45-9 | Molecular Weight | 290.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-tert-butylcyclohexylidene)methoxymethylsulfanylbenzene |
|---|
| Molecular Formula | C18H26OS |
|---|---|
| Molecular Weight | 290.46300 |
| Exact Mass | 290.17000 |
| PSA | 34.53000 |
| LogP | 5.87300 |
| InChIKey | DBXQEWKRXSRKCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(=COCSc2ccccc2)CC1 |
|
~%
(4-tert-butylcy... CAS#:93500-45-9 |
| Literature: Hackett, Steven; Livinghouse, Tom Journal of Organic Chemistry, 1986 , vol. 51, # 6 p. 879 - 885 |
|
~%
(4-tert-butylcy... CAS#:93500-45-9 |
| Literature: Hackett, Steven; Livinghouse, Tom Journal of Organic Chemistry, 1986 , vol. 51, # 6 p. 879 - 885 |